C21H50N4O7 — CID 177356981
(Z)-N-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]-2-hydrazinylprop-1-en-1-amine;ethane;2-(hydroxymethyl)oxane-3,4-diol (PubChem CID 177356981) has the molecular formula C21H50N4O7 and a molecular weight of 470.65 g/mol. Its IUPAC name is (Z)-N-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]-2-hydrazinylprop-1-en-1-amine;ethane;2-(hydroxymethyl)oxane-3,4-diol.
| Compound Name | (Z)-N-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]-2-hydrazinylprop-1-en-1-amine;ethane;2-(hydroxymethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 177356981 |
| Molecular Formula | C21H50N4O7 |
| Molecular Weight | 470.65 g/mol |
| Exact Mass | 470.37 |
| IUPAC Name | (Z)-N-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]-2-hydrazinylprop-1-en-1-amine;ethane;2-(hydroxymethyl)oxane-3,4-diol |
| SMILES | C/C(=C/NCCOCCOCCOCCN)NN.CC.CC.OCC1OCCC(O)C1O |
| InChI | InChI=1S/C11H26N4O3.C6H12O4.2C2H6/c1-11(15-13)10-14-3-5-17-7-9-18-8-6-16-4-2-12;7-3-5-6(9)4(8)1-2-10-5;2*1-2/h10,14-15H,2-9,12-13H2,1H3;4-9H,1-3H2;2*1-2H3/b11-10-;;; |
| InChIKey | AJGHCHDCKMHVJV-RVVQQURLSA-N |
| XLogP | -0.55 |
| TPSA | 173.71 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.65 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|