C14H29NO7 — CID 129015327
(2R,3R,4R)-2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxymethyl]oxane-3,4-diol (PubChem CID 129015327) has the molecular formula C14H29NO7 and a molecular weight of 323.39 g/mol. Its IUPAC name is (2R,3R,4R)-2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxymethyl]oxane-3,4-diol.
| Compound Name | (2R,3R,4R)-2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxymethyl]oxane-3,4-diol |
|---|---|
| PubChem CID | 129015327 |
| Molecular Formula | C14H29NO7 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | (2R,3R,4R)-2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxymethyl]oxane-3,4-diol |
| SMILES | NCCOCCOCCOCCOC[C@H]1OCC[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C14H29NO7/c15-2-4-18-5-6-19-7-8-20-9-10-21-11-13-14(17)12(16)1-3-22-13/h12-14,16-17H,1-11,15H2/t12-,13-,14-/m1/s1 |
| InChIKey | YGXBMKYDKNJXJL-MGPQQGTHSA-N |
| XLogP | -1.48 |
| TPSA | 112.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|