C12H16O4 — CID 171557855
2-(phenoxymethyl)oxane-3,4-diol (PubChem CID 171557855) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is 2-(phenoxymethyl)oxane-3,4-diol.
| Compound Name | 2-(phenoxymethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 171557855 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 2-(phenoxymethyl)oxane-3,4-diol |
| SMILES | OC1CCOC(COc2ccccc2)C1O |
| InChI | InChI=1S/C12H16O4/c13-10-6-7-15-11(12(10)14)8-16-9-4-2-1-3-5-9/h1-5,10-14H,6-8H2 |
| InChIKey | LAYVRGUDDBCSFF-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |