C11H19N3O4 — CID 171558060
2-(hydroxymethyl)oxane-3,4-diol;6-methylpyrazin-2-amine (PubChem CID 171558060) has the molecular formula C11H19N3O4 and a molecular weight of 257.29 g/mol. Its IUPAC name is 2-(hydroxymethyl)oxane-3,4-diol;6-methylpyrazin-2-amine.
| Compound Name | 2-(hydroxymethyl)oxane-3,4-diol;6-methylpyrazin-2-amine |
|---|---|
| PubChem CID | 171558060 |
| Molecular Formula | C11H19N3O4 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 2-(hydroxymethyl)oxane-3,4-diol;6-methylpyrazin-2-amine |
| SMILES | Cc1cncc(N)n1.OCC1OCCC(O)C1O |
| InChI | InChI=1S/C6H12O4.C5H7N3/c7-3-5-6(9)4(8)1-2-10-5;1-4-2-7-3-5(6)8-4/h4-9H,1-3H2;2-3H,1H3,(H2,6,8) |
| InChIKey | PNLCDTCRBRSNKL-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 121.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |