C10H20N2O4 — CID 176953237
1-[(3,4-dihydroxyoxan-2-yl)methyl]-3-propan-2-ylurea (PubChem CID 176953237) has the molecular formula C10H20N2O4 and a molecular weight of 232.28 g/mol. Its IUPAC name is 1-[(3,4-dihydroxyoxan-2-yl)methyl]-3-propan-2-ylurea.
| Compound Name | 1-[(3,4-dihydroxyoxan-2-yl)methyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 176953237 |
| Molecular Formula | C10H20N2O4 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | 1-[(3,4-dihydroxyoxan-2-yl)methyl]-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)NCC1OCCC(O)C1O |
| InChI | InChI=1S/C10H20N2O4/c1-6(2)12-10(15)11-5-8-9(14)7(13)3-4-16-8/h6-9,13-14H,3-5H2,1-2H3,(H2,11,12,15) |
| InChIKey | OVDZELRWNIIYLJ-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |