C11H15N3O4 — CID 171557478
N-[(3,4-dihydroxyoxan-2-yl)methyl]pyrimidine-2-carboxamide (PubChem CID 171557478) has the molecular formula C11H15N3O4 and a molecular weight of 253.26 g/mol. Its IUPAC name is N-[(3,4-dihydroxyoxan-2-yl)methyl]pyrimidine-2-carboxamide.
| Compound Name | N-[(3,4-dihydroxyoxan-2-yl)methyl]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 171557478 |
| Molecular Formula | C11H15N3O4 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | N-[(3,4-dihydroxyoxan-2-yl)methyl]pyrimidine-2-carboxamide |
| SMILES | O=C(NCC1OCCC(O)C1O)c1ncccn1 |
| InChI | InChI=1S/C11H15N3O4/c15-7-2-5-18-8(9(7)16)6-14-11(17)10-12-3-1-4-13-10/h1,3-4,7-9,15-16H,2,5-6H2,(H,14,17) |
| InChIKey | WFJDDMICOURSNB-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |