C18H20N2O4 — CID 171556730
N-[(3,4-dihydroxyoxan-2-yl)methyl]-6-phenylpyridine-3-carboxamide (PubChem CID 171556730) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is N-[(3,4-dihydroxyoxan-2-yl)methyl]-6-phenylpyridine-3-carboxamide.
| Compound Name | N-[(3,4-dihydroxyoxan-2-yl)methyl]-6-phenylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 171556730 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | N-[(3,4-dihydroxyoxan-2-yl)methyl]-6-phenylpyridine-3-carboxamide |
| SMILES | O=C(NCC1OCCC(O)C1O)c1ccc(-c2ccccc2)nc1 |
| InChI | InChI=1S/C18H20N2O4/c21-15-8-9-24-16(17(15)22)11-20-18(23)13-6-7-14(19-10-13)12-4-2-1-3-5-12/h1-7,10,15-17,21-22H,8-9,11H2,(H,20,23) |
| InChIKey | GWHWHJXLKSMXDV-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |