C12H16N2O4 — CID 171557176
N-[(3,4-dihydroxyoxan-2-yl)methyl]pyridine-3-carboxamide (PubChem CID 171557176) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is N-[(3,4-dihydroxyoxan-2-yl)methyl]pyridine-3-carboxamide.
| Compound Name | N-[(3,4-dihydroxyoxan-2-yl)methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 171557176 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | N-[(3,4-dihydroxyoxan-2-yl)methyl]pyridine-3-carboxamide |
| SMILES | O=C(NCC1OCCC(O)C1O)c1cccnc1 |
| InChI | InChI=1S/C12H16N2O4/c15-9-3-5-18-10(11(9)16)7-14-12(17)8-2-1-4-13-6-8/h1-2,4,6,9-11,15-16H,3,5,7H2,(H,14,17) |
| InChIKey | JJLAZMDSRUJGPL-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |