C10H12N2O3 — CID 166709002
(oxetan-2-ylmethylamino) pyridine-3-carboxylate (PubChem CID 166709002) has the molecular formula C10H12N2O3 and a molecular weight of 208.22 g/mol. Its IUPAC name is (oxetan-2-ylmethylamino) pyridine-3-carboxylate.
| Compound Name | (oxetan-2-ylmethylamino) pyridine-3-carboxylate |
|---|---|
| PubChem CID | 166709002 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | (oxetan-2-ylmethylamino) pyridine-3-carboxylate |
| SMILES | O=C(ONCC1CCO1)c1cccnc1 |
| InChI | InChI=1S/C10H12N2O3/c13-10(8-2-1-4-11-6-8)15-12-7-9-3-5-14-9/h1-2,4,6,9,12H,3,5,7H2 |
| InChIKey | MGMLWSXASHALPX-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|