C15H22N4O3 — CID 125145459
N-[2-[[(2S)-oxan-2-yl]methylcarbamoylamino]ethyl]pyridine-3-carboxamide (PubChem CID 125145459) has the molecular formula C15H22N4O3 and a molecular weight of 306.37 g/mol. Its IUPAC name is N-[2-[[(2S)-oxan-2-yl]methylcarbamoylamino]ethyl]pyridine-3-carboxamide.
| Compound Name | N-[2-[[(2S)-oxan-2-yl]methylcarbamoylamino]ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 125145459 |
| Molecular Formula | C15H22N4O3 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | N-[2-[[(2S)-oxan-2-yl]methylcarbamoylamino]ethyl]pyridine-3-carboxamide |
| SMILES | O=C(NCCNC(=O)c1cccnc1)NC[C@@H]1CCCCO1 |
| InChI | InChI=1S/C15H22N4O3/c20-14(12-4-3-6-16-10-12)17-7-8-18-15(21)19-11-13-5-1-2-9-22-13/h3-4,6,10,13H,1-2,5,7-9,11H2,(H,17,20)(H2,18,19,21)/t13-/m0/s1 |
| InChIKey | HZUBJUCKUZHWFQ-ZDUSSCGKSA-N |
| XLogP | 0.68 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|