C20H25N5O3 — CID 72875380
N-(oxolan-2-ylmethyl)-4-[2-(pyridin-3-ylamino)ethylcarbamoylamino]benzamide (PubChem CID 72875380) has the molecular formula C20H25N5O3 and a molecular weight of 383.45 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-4-[2-(pyridin-3-ylamino)ethylcarbamoylamino]benzamide.
| Compound Name | N-(oxolan-2-ylmethyl)-4-[2-(pyridin-3-ylamino)ethylcarbamoylamino]benzamide |
|---|---|
| PubChem CID | 72875380 |
| Molecular Formula | C20H25N5O3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-4-[2-(pyridin-3-ylamino)ethylcarbamoylamino]benzamide |
| SMILES | O=C(NCCNc1cccnc1)Nc1ccc(C(=O)NCC2CCCO2)cc1 |
| InChI | InChI=1S/C20H25N5O3/c26-19(24-14-18-4-2-12-28-18)15-5-7-16(8-6-15)25-20(27)23-11-10-22-17-3-1-9-21-13-17/h1,3,5-9,13,18,22H,2,4,10-12,14H2,(H,24,26)(H2,23,25,27) |
| InChIKey | OHFHMQORXXONHT-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 104.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|