C21H24N4O3 — CID 97278305
N-[4-[[(2S)-oxolan-2-yl]methylcarbamoyl]phenyl]-3-pyridin-3-ylazetidine-1-carboxamide (PubChem CID 97278305) has the molecular formula C21H24N4O3 and a molecular weight of 380.45 g/mol. Its IUPAC name is N-[4-[[(2S)-oxolan-2-yl]methylcarbamoyl]phenyl]-3-pyridin-3-ylazetidine-1-carboxamide.
| Compound Name | N-[4-[[(2S)-oxolan-2-yl]methylcarbamoyl]phenyl]-3-pyridin-3-ylazetidine-1-carboxamide |
|---|---|
| PubChem CID | 97278305 |
| Molecular Formula | C21H24N4O3 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | N-[4-[[(2S)-oxolan-2-yl]methylcarbamoyl]phenyl]-3-pyridin-3-ylazetidine-1-carboxamide |
| SMILES | O=C(NC[C@@H]1CCCO1)c1ccc(NC(=O)N2CC(c3cccnc3)C2)cc1 |
| InChI | InChI=1S/C21H24N4O3/c26-20(23-12-19-4-2-10-28-19)15-5-7-18(8-6-15)24-21(27)25-13-17(14-25)16-3-1-9-22-11-16/h1,3,5-9,11,17,19H,2,4,10,12-14H2,(H,23,26)(H,24,27)/t19-/m0/s1 |
| InChIKey | VNRDNVZWOIAFQX-IBGZPJMESA-N |
| XLogP | 2.62 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |