C17H29NO4 — CID 171557267
N-[(3,4-dihydroxyoxan-2-yl)methyl]-3-ethyl-1-methyl-5-methylidenecyclohexane-1-carboxamide (PubChem CID 171557267) has the molecular formula C17H29NO4 and a molecular weight of 311.42 g/mol. Its IUPAC name is N-[(3,4-dihydroxyoxan-2-yl)methyl]-3-ethyl-1-methyl-5-methylidenecyclohexane-1-carboxamide.
| Compound Name | N-[(3,4-dihydroxyoxan-2-yl)methyl]-3-ethyl-1-methyl-5-methylidenecyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 171557267 |
| Molecular Formula | C17H29NO4 |
| Molecular Weight | 311.42 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | N-[(3,4-dihydroxyoxan-2-yl)methyl]-3-ethyl-1-methyl-5-methylidenecyclohexane-1-carboxamide |
| SMILES | C=C1CC(CC)CC(C)(C(=O)NCC2OCCC(O)C2O)C1 |
| InChI | InChI=1S/C17H29NO4/c1-4-12-7-11(2)8-17(3,9-12)16(21)18-10-14-15(20)13(19)5-6-22-14/h12-15,19-20H,2,4-10H2,1,3H3,(H,18,21) |
| InChIKey | NVOBXEZOQZWSJA-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.42 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|