C18H31NO4 — CID 177015476
N-[(3,4-dihydroxyoxan-2-yl)methyl]-3-ethyl-N,1-dimethyl-5-methylidenecyclohexane-1-carboxamide (PubChem CID 177015476) has the molecular formula C18H31NO4 and a molecular weight of 325.45 g/mol. Its IUPAC name is N-[(3,4-dihydroxyoxan-2-yl)methyl]-3-ethyl-N,1-dimethyl-5-methylidenecyclohexane-1-carboxamide.
| Compound Name | N-[(3,4-dihydroxyoxan-2-yl)methyl]-3-ethyl-N,1-dimethyl-5-methylidenecyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 177015476 |
| Molecular Formula | C18H31NO4 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.23 |
| IUPAC Name | N-[(3,4-dihydroxyoxan-2-yl)methyl]-3-ethyl-N,1-dimethyl-5-methylidenecyclohexane-1-carboxamide |
| SMILES | C=C1CC(CC)CC(C)(C(=O)N(C)CC2OCCC(O)C2O)C1 |
| InChI | InChI=1S/C18H31NO4/c1-5-13-8-12(2)9-18(3,10-13)17(22)19(4)11-15-16(21)14(20)6-7-23-15/h13-16,20-21H,2,5-11H2,1,3-4H3 |
| InChIKey | QJJKFJFWKPERRN-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|