C22H43NO4 — CID 156647065
2-(5,6-dimethyl-4-methylideneoxan-2-yl)-N-[(5,5-dimethyloxan-2-yl)methyl]acetamide;methane;propan-1-ol (PubChem CID 156647065) has the molecular formula C22H43NO4 and a molecular weight of 385.59 g/mol. Its IUPAC name is 2-(5,6-dimethyl-4-methylideneoxan-2-yl)-N-[(5,5-dimethyloxan-2-yl)methyl]acetamide;methane;propan-1-ol.
| Compound Name | 2-(5,6-dimethyl-4-methylideneoxan-2-yl)-N-[(5,5-dimethyloxan-2-yl)methyl]acetamide;methane;propan-1-ol |
|---|---|
| PubChem CID | 156647065 |
| Molecular Formula | C22H43NO4 |
| Molecular Weight | 385.59 g/mol |
| Exact Mass | 385.32 |
| IUPAC Name | 2-(5,6-dimethyl-4-methylideneoxan-2-yl)-N-[(5,5-dimethyloxan-2-yl)methyl]acetamide;methane;propan-1-ol |
| SMILES | C.C=C1CC(CC(=O)NCC2CCC(C)(C)CO2)OC(C)C1C.CCCO |
| InChI | InChI=1S/C18H31NO3.C3H8O.CH4/c1-12-8-16(22-14(3)13(12)2)9-17(20)19-10-15-6-7-18(4,5)11-21-15;1-2-3-4;/h13-16H,1,6-11H2,2-5H3,(H,19,20);4H,2-3H2,1H3;1H4 |
| InChIKey | QSYDOUXUYVIVES-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.59 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|