C21H39NO5 — CID 142428431
N-[(5,5-dimethyloxan-2-yl)methyl]-2-[(2R)-2-hydroxy-5,6-dimethyl-4-methylideneoxan-2-yl]acetamide;propan-1-ol (PubChem CID 142428431) has the molecular formula C21H39NO5 and a molecular weight of 385.55 g/mol. Its IUPAC name is N-[(5,5-dimethyloxan-2-yl)methyl]-2-[(2R)-2-hydroxy-5,6-dimethyl-4-methylideneoxan-2-yl]acetamide;propan-1-ol.
| Compound Name | N-[(5,5-dimethyloxan-2-yl)methyl]-2-[(2R)-2-hydroxy-5,6-dimethyl-4-methylideneoxan-2-yl]acetamide;propan-1-ol |
|---|---|
| PubChem CID | 142428431 |
| Molecular Formula | C21H39NO5 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.28 |
| IUPAC Name | N-[(5,5-dimethyloxan-2-yl)methyl]-2-[(2R)-2-hydroxy-5,6-dimethyl-4-methylideneoxan-2-yl]acetamide;propan-1-ol |
| SMILES | C=C1C[C@](O)(CC(=O)NCC2CCC(C)(C)CO2)OC(C)C1C.CCCO |
| InChI | InChI=1S/C18H31NO4.C3H8O/c1-12-8-18(21,23-14(3)13(12)2)9-16(20)19-10-15-6-7-17(4,5)11-22-15;1-2-3-4/h13-15,21H,1,6-11H2,2-5H3,(H,19,20);4H,2-3H2,1H3/t13?,14?,15?,18-;/m1./s1 |
| InChIKey | CWTHRLRTQVKATB-VVQOZKOHSA-N |
| XLogP | 2.78 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|