C20H37NO5 — CID 143946979
N-[(6-butyl-4-hydroxy-5,5-dimethyloxan-2-yl)-methoxymethyl]-2-hydroxy-5-methylhex-5-enamide (PubChem CID 143946979) has the molecular formula C20H37NO5 and a molecular weight of 371.52 g/mol. Its IUPAC name is N-[(6-butyl-4-hydroxy-5,5-dimethyloxan-2-yl)-methoxymethyl]-2-hydroxy-5-methylhex-5-enamide.
| Compound Name | N-[(6-butyl-4-hydroxy-5,5-dimethyloxan-2-yl)-methoxymethyl]-2-hydroxy-5-methylhex-5-enamide |
|---|---|
| PubChem CID | 143946979 |
| Molecular Formula | C20H37NO5 |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.27 |
| IUPAC Name | N-[(6-butyl-4-hydroxy-5,5-dimethyloxan-2-yl)-methoxymethyl]-2-hydroxy-5-methylhex-5-enamide |
| SMILES | C=C(C)CCC(O)C(=O)NC(OC)C1CC(O)C(C)(C)C(CCCC)O1 |
| InChI | InChI=1S/C20H37NO5/c1-7-8-9-17-20(4,5)16(23)12-15(26-17)19(25-6)21-18(24)14(22)11-10-13(2)3/h14-17,19,22-23H,2,7-12H2,1,3-6H3,(H,21,24) |
| InChIKey | ZTZTUYWJEFUOQS-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|