C23H41F2NO7 — CID 143918596
N-[(6R)-4,4-difluoro-6,9-dihydroxy-1,8-dimethoxy-5,5-dimethylnonyl]-2-[(5R)-5,6-dimethyl-4-methylideneoxan-2-yl]-2-hydroxyacetamide (PubChem CID 143918596) has the molecular formula C23H41F2NO7 and a molecular weight of 481.58 g/mol. Its IUPAC name is N-[(6R)-4,4-difluoro-6,9-dihydroxy-1,8-dimethoxy-5,5-dimethylnonyl]-2-[(5R)-5,6-dimethyl-4-methylideneoxan-2-yl]-2-hydroxyacetamide.
| Compound Name | N-[(6R)-4,4-difluoro-6,9-dihydroxy-1,8-dimethoxy-5,5-dimethylnonyl]-2-[(5R)-5,6-dimethyl-4-methylideneoxan-2-yl]-2-hydroxyacetamide |
|---|---|
| PubChem CID | 143918596 |
| Molecular Formula | C23H41F2NO7 |
| Molecular Weight | 481.58 g/mol |
| Exact Mass | 481.29 |
| IUPAC Name | N-[(6R)-4,4-difluoro-6,9-dihydroxy-1,8-dimethoxy-5,5-dimethylnonyl]-2-[(5R)-5,6-dimethyl-4-methylideneoxan-2-yl]-2-hydroxyacetamide |
| SMILES | C=C1CC(C(O)C(=O)NC(CCC(F)(F)C(C)(C)[C@H](O)CC(CO)OC)OC)OC(C)[C@@H]1C |
| InChI | InChI=1S/C23H41F2NO7/c1-13-10-17(33-15(3)14(13)2)20(29)21(30)26-19(32-7)8-9-23(24,25)22(4,5)18(28)11-16(12-27)31-6/h14-20,27-29H,1,8-12H2,2-7H3,(H,26,30)/t14-,15?,16?,17?,18-,19?,20?/m1/s1 |
| InChIKey | OZEFVYYJCWLVET-QUJYSYLXSA-N |
| XLogP | 2.01 |
| TPSA | 117.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.58 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|