C32H53F2NO8 — CID 143918777
(2E,5E)-19-[[(2S)-2-[(5R)-5,6-dimethyl-4-methylideneoxan-2-yl]-2-hydroxyacetyl]amino]-16,16-difluoro-10,13-dihydroxy-19-methoxy-15,15-dimethylnonadeca-2,5-dienoic acid (PubChem CID 143918777) has the molecular formula C32H53F2NO8 and a molecular weight of 617.77 g/mol. Its IUPAC name is (2E,5E)-19-[[(2S)-2-[(5R)-5,6-dimethyl-4-methylideneoxan-2-yl]-2-hydroxyacetyl]amino]-16,16-difluoro-10,13-dihydroxy-19-methoxy-15,15-dimethylnonadeca-2,5-dienoic acid.
| Compound Name | (2E,5E)-19-[[(2S)-2-[(5R)-5,6-dimethyl-4-methylideneoxan-2-yl]-2-hydroxyacetyl]amino]-16,16-difluoro-10,13-dihydroxy-19-methoxy-15,15-dimethylnonadeca-2,5-dienoic acid |
|---|---|
| PubChem CID | 143918777 |
| Molecular Formula | C32H53F2NO8 |
| Molecular Weight | 617.77 g/mol |
| Exact Mass | 617.37 |
| IUPAC Name | (2E,5E)-19-[[(2S)-2-[(5R)-5,6-dimethyl-4-methylideneoxan-2-yl]-2-hydroxyacetyl]amino]-16,16-difluoro-10,13-dihydroxy-19-methoxy-15,15-dimethylnonadeca-2,5-dienoic acid |
| SMILES | C=C1CC([C@H](O)C(=O)NC(CCC(F)(F)C(C)(C)CC(O)CCC(O)CCC/C=C/C/C=C/C(=O)O)OC)OC(C)[C@@H]1C |
| InChI | InChI=1S/C32H53F2NO8/c1-21-19-26(43-23(3)22(21)2)29(40)30(41)35-27(42-6)17-18-32(33,34)31(4,5)20-25(37)16-15-24(36)13-11-9-7-8-10-12-14-28(38)39/h7-8,12,14,22-27,29,36-37,40H,1,9-11,13,15-20H2,2-6H3,(H,35,41)(H,38,39)/b8-7+,14-12+/t22-,23?,24?,25?,26?,27?,29+/m1/s1 |
| InChIKey | DDHYLZSJIHMMIK-ATGQWLAOSA-N |
| XLogP | 4.90 |
| TPSA | 145.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.77 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|