C26H51NO7 — CID 143918587
2-(5,6-dimethyl-4-methylideneoxan-2-yl)-N-(5-ethyl-6-hydroxy-1,8,9-trimethoxynonyl)-2-hydroxyacetamide;ethane (PubChem CID 143918587) has the molecular formula C26H51NO7 and a molecular weight of 489.69 g/mol. Its IUPAC name is 2-(5,6-dimethyl-4-methylideneoxan-2-yl)-N-(5-ethyl-6-hydroxy-1,8,9-trimethoxynonyl)-2-hydroxyacetamide;ethane.
| Compound Name | 2-(5,6-dimethyl-4-methylideneoxan-2-yl)-N-(5-ethyl-6-hydroxy-1,8,9-trimethoxynonyl)-2-hydroxyacetamide;ethane |
|---|---|
| PubChem CID | 143918587 |
| Molecular Formula | C26H51NO7 |
| Molecular Weight | 489.69 g/mol |
| Exact Mass | 489.37 |
| IUPAC Name | 2-(5,6-dimethyl-4-methylideneoxan-2-yl)-N-(5-ethyl-6-hydroxy-1,8,9-trimethoxynonyl)-2-hydroxyacetamide;ethane |
| SMILES | C=C1CC(C(O)C(=O)NC(CCCC(CC)C(O)CC(COC)OC)OC)OC(C)C1C.CC |
| InChI | InChI=1S/C24H45NO7.C2H6/c1-8-18(20(26)13-19(30-6)14-29-5)10-9-11-22(31-7)25-24(28)23(27)21-12-15(2)16(3)17(4)32-21;1-2/h16-23,26-27H,2,8-14H2,1,3-7H3,(H,25,28);1-2H3 |
| InChIKey | HTHYQJYLFAYMGJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 106.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.69 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|