C11H15N5O — CID 110430172
N-[2-[(6-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]ethyl]acetamide (PubChem CID 110430172) has the molecular formula C11H15N5O and a molecular weight of 233.27 g/mol. Its IUPAC name is N-[2-[(6-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]ethyl]acetamide.
| Compound Name | N-[2-[(6-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]ethyl]acetamide |
|---|---|
| PubChem CID | 110430172 |
| Molecular Formula | C11H15N5O |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | N-[2-[(6-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]ethyl]acetamide |
| SMILES | CC(=O)NCCNc1ncnc2[nH]c(C)cc12 |
| InChI | InChI=1S/C11H15N5O/c1-7-5-9-10(13-4-3-12-8(2)17)14-6-15-11(9)16-7/h5-6H,3-4H2,1-2H3,(H,12,17)(H2,13,14,15,16) |
| InChIKey | CGPOGRYBLSCVBJ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|