About (4-methyl-1,8-naphthyridin-2-yl)hydrazine
(4-methyl-1,8-naphthyridin-2-yl)hydrazine (PubChem CID 23008691) has the molecular formula C9H10N4
and a molecular weight of 174.21 g/mol. Its IUPAC name is (4-methyl-1,8-naphthyridin-2-yl)hydrazine.
Molecular Properties
| Compound Name | (4-methyl-1,8-naphthyridin-2-yl)hydrazine |
| PubChem CID | 23008691 |
| Molecular Formula | C9H10N4 |
| Molecular Weight | 174.21 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | (4-methyl-1,8-naphthyridin-2-yl)hydrazine |
| SMILES | Cc1cc(NN)nc2ncccc12 |
| InChI | InChI=1S/C9H10N4/c1-6-5-8(13-10)12-9-7(6)3-2-4-11-9/h2-5H,10H2,1H3,(H,11,12,13) |
| InChIKey | ZXLSQNBMZRSRJC-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.21 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-methyl-1,8-naphthyridin-2-yl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methyl-1,8-naphthyridin-2-yl)hydrazine?
The IUPAC name of (4-methyl-1,8-naphthyridin-2-yl)hydrazine (CID 23008691) is (4-methyl-1,8-naphthyridin-2-yl)hydrazine.
What is the SMILES notation for (4-methyl-1,8-naphthyridin-2-yl)hydrazine?
The canonical SMILES for (4-methyl-1,8-naphthyridin-2-yl)hydrazine is Cc1cc(NN)nc2ncccc12.
What is the InChIKey of (4-methyl-1,8-naphthyridin-2-yl)hydrazine?
The InChIKey is ZXLSQNBMZRSRJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4/c1-6-5-8(13-10)12-9-7(6)3-2-4-11-9/h2-5H,10H2,1H3,(H,11,12,13).
What are the key properties of (4-methyl-1,8-naphthyridin-2-yl)hydrazine?
(4-methyl-1,8-naphthyridin-2-yl)hydrazine has a molecular weight of 174.21 g/mol, XLogP of 1.22, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methyl-1,8-naphthyridin-2-yl)hydrazine is sourced from PubChem (CID 23008691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).