C9H10N4 — CID 23008691
(4-methyl-1,8-naphthyridin-2-yl)hydrazine (PubChem CID 23008691) has the molecular formula C9H10N4 and a molecular weight of 174.21 g/mol. Its IUPAC name is (4-methyl-1,8-naphthyridin-2-yl)hydrazine.
| Compound Name | (4-methyl-1,8-naphthyridin-2-yl)hydrazine |
|---|---|
| PubChem CID | 23008691 |
| Molecular Formula | C9H10N4 |
| Molecular Weight | 174.21 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | (4-methyl-1,8-naphthyridin-2-yl)hydrazine |
| SMILES | Cc1cc(NN)nc2ncccc12 |
| InChI | InChI=1S/C9H10N4/c1-6-5-8(13-10)12-9-7(6)3-2-4-11-9/h2-5H,10H2,1H3,(H,11,12,13) |
| InChIKey | ZXLSQNBMZRSRJC-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.21 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|