C15H15N5 — CID 5328116
6-(2,6-dimethylphenyl)pyrido[2,3-d]pyrimidine-2,7-diamine (PubChem CID 5328116) has the molecular formula C15H15N5 and a molecular weight of 265.32 g/mol. Its IUPAC name is 6-(2,6-dimethylphenyl)pyrido[2,3-d]pyrimidine-2,7-diamine.
| Compound Name | 6-(2,6-dimethylphenyl)pyrido[2,3-d]pyrimidine-2,7-diamine |
|---|---|
| PubChem CID | 5328116 |
| Molecular Formula | C15H15N5 |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 6-(2,6-dimethylphenyl)pyrido[2,3-d]pyrimidine-2,7-diamine |
| SMILES | Cc1cccc(C)c1-c1cc2cnc(N)nc2nc1N |
| InChI | InChI=1S/C15H15N5/c1-8-4-3-5-9(2)12(8)11-6-10-7-18-15(17)20-14(10)19-13(11)16/h3-7H,1-2H3,(H4,16,17,18,19,20) |
| InChIKey | LSHICSIXTRDLPS-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |