C16H17N4+ — CID 123261748
2,2-diethyl-3,7,10-triaza-1-azoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4(16),5,7,9,11(15),12-heptaene (PubChem CID 123261748) has the molecular formula C16H17N4+ and a molecular weight of 265.34 g/mol. Its IUPAC name is 2,2-diethyl-3,7,10-triaza-1-azoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4(16),5,7,9,11(15),12-heptaene.
| Compound Name | 2,2-diethyl-3,7,10-triaza-1-azoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4(16),5,7,9,11(15),12-heptaene |
|---|---|
| PubChem CID | 123261748 |
| Molecular Formula | C16H17N4+ |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | 2,2-diethyl-3,7,10-triaza-1-azoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4(16),5,7,9,11(15),12-heptaene |
| SMILES | CCC1(CC)Nc2ccnc3cnc4ccc[n+]1c4c23 |
| InChI | InChI=1S/C16H16N4/c1-3-16(4-2)19-11-7-8-17-13-10-18-12-6-5-9-20(16)15(12)14(11)13/h5-10H,3-4H2,1-2H3/p+1 |
| InChIKey | RQAYUIGXLFEVLV-UHFFFAOYSA-O |
| XLogP | 2.97 |
| TPSA | 41.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|