C9H9N3 — CID 118375841
2-ethylpyrido[3,2-d]pyrimidine (PubChem CID 118375841) has the molecular formula C9H9N3 and a molecular weight of 159.19 g/mol. Its IUPAC name is 2-ethylpyrido[3,2-d]pyrimidine.
| Compound Name | 2-ethylpyrido[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 118375841 |
| Molecular Formula | C9H9N3 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.08 |
| IUPAC Name | 2-ethylpyrido[3,2-d]pyrimidine |
| SMILES | CCc1ncc2ncccc2n1 |
| InChI | InChI=1S/C9H9N3/c1-2-9-11-6-8-7(12-9)4-3-5-10-8/h3-6H,2H2,1H3 |
| InChIKey | MPWGNLUCDZCHNS-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |