C35H48N3+ — CID 123980496
12-tert-butyl-19,20-diethyl-5,5,6,6,7,7,19,20-octamethyl-11,13-diaza-1-azoniahexacyclo[12.6.2.02,10.04,8.011,21.018,22]docosa-1(21),2(10),3,8,12,14,16,18(22)-octaene (PubChem CID 123980496) has the molecular formula C35H48N3+ and a molecular weight of 510.79 g/mol. Its IUPAC name is 12-tert-butyl-19,20-diethyl-5,5,6,6,7,7,19,20-octamethyl-11,13-diaza-1-azoniahexacyclo[12.6.2.02,10.04,8.011,21.018,22]docosa-1(21),2(10),3,8,12,14,16,18(22)-octaene.
| Compound Name | 12-tert-butyl-19,20-diethyl-5,5,6,6,7,7,19,20-octamethyl-11,13-diaza-1-azoniahexacyclo[12.6.2.02,10.04,8.011,21.018,22]docosa-1(21),2(10),3,8,12,14,16,18(22)-octaene |
|---|---|
| PubChem CID | 123980496 |
| Molecular Formula | C35H48N3+ |
| Molecular Weight | 510.79 g/mol |
| Exact Mass | 510.38 |
| IUPAC Name | 12-tert-butyl-19,20-diethyl-5,5,6,6,7,7,19,20-octamethyl-11,13-diaza-1-azoniahexacyclo[12.6.2.02,10.04,8.011,21.018,22]docosa-1(21),2(10),3,8,12,14,16,18(22)-octaene |
| SMILES | CCC1(C)c2cccc3nc(C(C)(C)C)n4c5cc6c(cc5[n+](c4c23)C1(C)CC)C(C)(C)C(C)(C)C6(C)C |
| InChI | InChI=1S/C35H48N3/c1-14-34(12)21-17-16-18-24-27(21)28-37(29(36-24)30(3,4)5)25-19-22-23(20-26(25)38(28)35(34,13)15-2)32(8,9)33(10,11)31(22,6)7/h16-20H,14-15H2,1-13H3/q+1 |
| InChIKey | DPPNTPFUWQJWGA-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 21.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.79 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|