C35H49N3 — CID 123641624
20-tert-butyl-5,7,7-trimethyl-14-(3-methylpentan-3-yl)-5-pentyl-1,11,19-triazapentacyclo[10.8.0.02,10.04,8.013,18]icosa-2(10),3,8,11,13,15,17,19-octaene (PubChem CID 123641624) has the molecular formula C35H49N3 and a molecular weight of 511.80 g/mol. Its IUPAC name is 20-tert-butyl-5,7,7-trimethyl-14-(3-methylpentan-3-yl)-5-pentyl-1,11,19-triazapentacyclo[10.8.0.02,10.04,8.013,18]icosa-2(10),3,8,11,13,15,17,19-octaene.
| Compound Name | 20-tert-butyl-5,7,7-trimethyl-14-(3-methylpentan-3-yl)-5-pentyl-1,11,19-triazapentacyclo[10.8.0.02,10.04,8.013,18]icosa-2(10),3,8,11,13,15,17,19-octaene |
|---|---|
| PubChem CID | 123641624 |
| Molecular Formula | C35H49N3 |
| Molecular Weight | 511.80 g/mol |
| Exact Mass | 511.39 |
| IUPAC Name | 20-tert-butyl-5,7,7-trimethyl-14-(3-methylpentan-3-yl)-5-pentyl-1,11,19-triazapentacyclo[10.8.0.02,10.04,8.013,18]icosa-2(10),3,8,11,13,15,17,19-octaene |
| SMILES | CCCCCC1(C)CC(C)(C)c2cc3nc4c5c(C(C)(CC)CC)cccc5nc(C(C)(C)C)n4c3cc21 |
| InChI | InChI=1S/C35H49N3/c1-11-14-15-19-35(10)22-33(7,8)24-20-27-28(21-25(24)35)38-30(36-27)29-23(34(9,12-2)13-3)17-16-18-26(29)37-31(38)32(4,5)6/h16-18,20-21H,11-15,19,22H2,1-10H3 |
| InChIKey | ULIBWMFPWWNRSK-UHFFFAOYSA-N |
| XLogP | 9.93 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.80 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|