C26H29IrN2- — CID 149012346
CID 149012346 (PubChem CID 149012346) has the molecular formula C26H29IrN2- and a molecular weight of 561.75 g/mol.
| Compound Name | CID 149012346 |
|---|---|
| PubChem CID | 149012346 |
| Molecular Formula | C26H29IrN2- |
| Molecular Weight | 561.75 g/mol |
| Exact Mass | 562.20 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1cc2ccc[c-]c2c2nc3cc4c(cc3n12)C(C)(C)CC4(C)C.[Ir] |
| InChI | InChI=1S/C26H29N2.Ir/c1-24(2,3)22-12-16-10-8-9-11-17(16)23-27-20-13-18-19(14-21(20)28(22)23)26(6,7)15-25(18,4)5;/h8-10,12-14H,15H2,1-7H3;/q-1; |
| InChIKey | AKTLXBUNELLOKI-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.75 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|