About CID 140687843
CID 140687843 (PubChem CID 140687843) has the molecular formula C29H33IrN2-
and a molecular weight of 601.81 g/mol.
Molecular Properties
| Compound Name | CID 140687843 |
| PubChem CID | 140687843 |
| Molecular Formula | C29H33IrN2- |
| Molecular Weight | 601.81 g/mol |
| Exact Mass | 602.23 |
| IUPAC Name | — |
| SMILES | CC1(C)c2cc3nc4c5[c-]cccc5ccn4c3c3c2C(C)(C1(C)C)C(C)(C)C3(C)C.[Ir] |
| InChI | InChI=1S/C29H33N2.Ir/c1-25(2)19-16-20-23(31-15-14-17-12-10-11-13-18(17)24(31)30-20)22-21(19)29(9,27(25,5)6)28(7,8)26(22,3)4;/h10-12,14-16H,1-9H3;/q-1; |
| InChIKey | ZASWTLXNCYIENI-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 601.81 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 140687843 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140687843?
The IUPAC name of CID 140687843 (CID 140687843) is not available.
What is the SMILES notation for CID 140687843?
The canonical SMILES for CID 140687843 is CC1(C)c2cc3nc4c5[c-]cccc5ccn4c3c3c2C(C)(C1(C)C)C(C)(C)C3(C)C.[Ir].
What is the InChIKey of CID 140687843?
The InChIKey is ZASWTLXNCYIENI-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H33N2.Ir/c1-25(2)19-16-20-23(31-15-14-17-12-10-11-13-18(17)24(31)30-20)22-21(19)29(9,27(25,5)6)28(7,8)26(22,3)4;/h10-12,14-16H,1-9H3;/q-1;.
What are the key properties of CID 140687843?
CID 140687843 has a molecular weight of 601.81 g/mol, XLogP of 7.33, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140687843 is sourced from PubChem (CID 140687843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).