C17H21IrN2- — CID 140688538
2,3,5,5,6,6-hexamethyl-10H-imidazo[2,1-a]isoquinolin-10-ide;iridium (PubChem CID 140688538) has the molecular formula C17H21IrN2- and a molecular weight of 445.59 g/mol. Its IUPAC name is 2,3,5,5,6,6-hexamethyl-10H-imidazo[2,1-a]isoquinolin-10-ide;iridium.
| Compound Name | 2,3,5,5,6,6-hexamethyl-10H-imidazo[2,1-a]isoquinolin-10-ide;iridium |
|---|---|
| PubChem CID | 140688538 |
| Molecular Formula | C17H21IrN2- |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 2,3,5,5,6,6-hexamethyl-10H-imidazo[2,1-a]isoquinolin-10-ide;iridium |
| SMILES | Cc1nc2n(c1C)C(C)(C)C(C)(C)c1ccc[c-]c1-2.[Ir] |
| InChI | InChI=1S/C17H21N2.Ir/c1-11-12(2)19-15(18-11)13-9-7-8-10-14(13)16(3,4)17(19,5)6;/h7-8,10H,1-6H3;/q-1; |
| InChIKey | LZVDLWSYKFLRTK-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|