C23H24Ir-2 — CID 155617855
15,15,16,16,17,17-hexamethyl-1,11-dihydrocyclopenta[a]phenanthrene-1,11-diide;iridium (PubChem CID 155617855) has the molecular formula C23H24Ir-2 and a molecular weight of 492.66 g/mol. Its IUPAC name is 15,15,16,16,17,17-hexamethyl-1,11-dihydrocyclopenta[a]phenanthrene-1,11-diide;iridium.
| Compound Name | 15,15,16,16,17,17-hexamethyl-1,11-dihydrocyclopenta[a]phenanthrene-1,11-diide;iridium |
|---|---|
| PubChem CID | 155617855 |
| Molecular Formula | C23H24Ir-2 |
| Molecular Weight | 492.66 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | 15,15,16,16,17,17-hexamethyl-1,11-dihydrocyclopenta[a]phenanthrene-1,11-diide;iridium |
| SMILES | CC1(C)c2c[c-]c3c(ccc4ccc[c-]c43)c2C(C)(C)C1(C)C.[Ir] |
| InChI | InChI=1S/C23H24.Ir/c1-21(2)19-14-13-17-16-10-8-7-9-15(16)11-12-18(17)20(19)22(3,4)23(21,5)6;/h7-9,11-12,14H,1-6H3;/q-2; |
| InChIKey | FMTHMYZQDSYHQF-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.66 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|