About 8-(trifluoromethyl)-1H-naphthalen-1-ide;yttrium
8-(trifluoromethyl)-1H-naphthalen-1-ide;yttrium (PubChem CID 166533772) has the molecular formula C11H6F3Y-
and a molecular weight of 284.07 g/mol. Its IUPAC name is 8-(trifluoromethyl)-1H-naphthalen-1-ide;yttrium.
Molecular Properties
| Compound Name | 8-(trifluoromethyl)-1H-naphthalen-1-ide;yttrium |
| PubChem CID | 166533772 |
| Molecular Formula | C11H6F3Y- |
| Molecular Weight | 284.07 g/mol |
| Exact Mass | 283.95 |
| IUPAC Name | 8-(trifluoromethyl)-1H-naphthalen-1-ide;yttrium |
| SMILES | FC(F)(F)c1cccc2ccc[c-]c12.[Y] |
| InChI | InChI=1S/C11H6F3.Y/c12-11(13,14)10-7-3-5-8-4-1-2-6-9(8)10;/h1-5,7H;/q-1; |
| InChIKey | KCHNZYBHRVPGAJ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.07 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 8-(trifluoromethyl)-1H-naphthalen-1-ide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(trifluoromethyl)-1H-naphthalen-1-ide;yttrium?
The IUPAC name of 8-(trifluoromethyl)-1H-naphthalen-1-ide;yttrium (CID 166533772) is 8-(trifluoromethyl)-1H-naphthalen-1-ide;yttrium.
What is the SMILES notation for 8-(trifluoromethyl)-1H-naphthalen-1-ide;yttrium?
The canonical SMILES for 8-(trifluoromethyl)-1H-naphthalen-1-ide;yttrium is FC(F)(F)c1cccc2ccc[c-]c12.[Y].
What is the InChIKey of 8-(trifluoromethyl)-1H-naphthalen-1-ide;yttrium?
The InChIKey is KCHNZYBHRVPGAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6F3.Y/c12-11(13,14)10-7-3-5-8-4-1-2-6-9(8)10;/h1-5,7H;/q-1;.
What are the key properties of 8-(trifluoromethyl)-1H-naphthalen-1-ide;yttrium?
8-(trifluoromethyl)-1H-naphthalen-1-ide;yttrium has a molecular weight of 284.07 g/mol, XLogP of 3.66, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(trifluoromethyl)-1H-naphthalen-1-ide;yttrium is sourced from PubChem (CID 166533772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).