C18H10F3IrN2- — CID 58517844
iridium;3-[2-(trifluoromethyl)phenyl]-10H-imidazo[2,1-a]isoquinolin-10-ide (PubChem CID 58517844) has the molecular formula C18H10F3IrN2- and a molecular weight of 503.50 g/mol. Its IUPAC name is iridium;3-[2-(trifluoromethyl)phenyl]-10H-imidazo[2,1-a]isoquinolin-10-ide.
| Compound Name | iridium;3-[2-(trifluoromethyl)phenyl]-10H-imidazo[2,1-a]isoquinolin-10-ide |
|---|---|
| PubChem CID | 58517844 |
| Molecular Formula | C18H10F3IrN2- |
| Molecular Weight | 503.50 g/mol |
| Exact Mass | 504.04 |
| IUPAC Name | iridium;3-[2-(trifluoromethyl)phenyl]-10H-imidazo[2,1-a]isoquinolin-10-ide |
| SMILES | FC(F)(F)c1ccccc1-c1cnc2c3[c-]cccc3ccn12.[Ir] |
| InChI | InChI=1S/C18H10F3N2.Ir/c19-18(20,21)15-8-4-3-7-14(15)16-11-22-17-13-6-2-1-5-12(13)9-10-23(16)17;/h1-5,7-11H;/q-1; |
| InChIKey | HJXIGKCWEXLVMA-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.50 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|