C8H3BrF6MgO — CID 139924766
magnesium;2,6-bis(trifluoromethyl)phenolate;bromide (PubChem CID 139924766) has the molecular formula C8H3BrF6MgO and a molecular weight of 333.31 g/mol. Its IUPAC name is magnesium;2,6-bis(trifluoromethyl)phenolate;bromide.
| Compound Name | magnesium;2,6-bis(trifluoromethyl)phenolate;bromide |
|---|---|
| PubChem CID | 139924766 |
| Molecular Formula | C8H3BrF6MgO |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 331.91 |
| IUPAC Name | magnesium;2,6-bis(trifluoromethyl)phenolate;bromide |
| SMILES | [Br-].[Mg+2].[O-]c1c(C(F)(F)F)cccc1C(F)(F)F |
| InChI | InChI=1S/C8H4F6O.BrH.Mg/c9-7(10,11)4-2-1-3-5(6(4)15)8(12,13)14;;/h1-3,15H;1H;/q;;+2/p-2 |
| InChIKey | LAGAWVSEUGMINN-UHFFFAOYSA-L |
| XLogP | -0.58 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |