C8H3ClF6O2S — CID 18981651
2,6-bis(trifluoromethyl)benzenesulfonyl chloride (PubChem CID 18981651) has the molecular formula C8H3ClF6O2S and a molecular weight of 312.62 g/mol. Its IUPAC name is 2,6-bis(trifluoromethyl)benzenesulfonyl chloride.
| Compound Name | 2,6-bis(trifluoromethyl)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 18981651 |
| Molecular Formula | C8H3ClF6O2S |
| Molecular Weight | 312.62 g/mol |
| Exact Mass | 311.94 |
| IUPAC Name | 2,6-bis(trifluoromethyl)benzenesulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1c(C(F)(F)F)cccc1C(F)(F)F |
| InChI | InChI=1S/C8H3ClF6O2S/c9-18(16,17)6-4(7(10,11)12)2-1-3-5(6)8(13,14)15/h1-3H |
| InChIKey | RQMBZKGYBUIIKQ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.62 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |