C7H6F3NO3S — CID 23216666
2-amino-6-(trifluoromethyl)benzenesulfonic acid (PubChem CID 23216666) has the molecular formula C7H6F3NO3S and a molecular weight of 241.19 g/mol. Its IUPAC name is 2-amino-6-(trifluoromethyl)benzenesulfonic acid.
| Compound Name | 2-amino-6-(trifluoromethyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 23216666 |
| Molecular Formula | C7H6F3NO3S |
| Molecular Weight | 241.19 g/mol |
| Exact Mass | 241.00 |
| IUPAC Name | 2-amino-6-(trifluoromethyl)benzenesulfonic acid |
| SMILES | Nc1cccc(C(F)(F)F)c1S(=O)(=O)O |
| InChI | InChI=1S/C7H6F3NO3S/c8-7(9,10)4-2-1-3-5(11)6(4)15(12,13)14/h1-3H,11H2,(H,12,13,14) |
| InChIKey | HCWNDUFWPLNWOO-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.19 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|