C7H6F3NO2S2 — CID 23448648
2-sulfanyl-6-(trifluoromethyl)benzenesulfonamide (PubChem CID 23448648) has the molecular formula C7H6F3NO2S2 and a molecular weight of 257.26 g/mol. Its IUPAC name is 2-sulfanyl-6-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 2-sulfanyl-6-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 23448648 |
| Molecular Formula | C7H6F3NO2S2 |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 256.98 |
| IUPAC Name | 2-sulfanyl-6-(trifluoromethyl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1c(S)cccc1C(F)(F)F |
| InChI | InChI=1S/C7H6F3NO2S2/c8-7(9,10)4-2-1-3-5(14)6(4)15(11,12)13/h1-3,14H,(H2,11,12,13) |
| InChIKey | JWFQVZQTEGETAK-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|