C8H5F3N2O2S — CID 118996048
2-cyano-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 118996048) has the molecular formula C8H5F3N2O2S and a molecular weight of 250.20 g/mol. Its IUPAC name is 2-cyano-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 2-cyano-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 118996048 |
| Molecular Formula | C8H5F3N2O2S |
| Molecular Weight | 250.20 g/mol |
| Exact Mass | 250.00 |
| IUPAC Name | 2-cyano-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | N#Cc1c(C(F)(F)F)cccc1S(N)(=O)=O |
| InChI | InChI=1S/C8H5F3N2O2S/c9-8(10,11)6-2-1-3-7(5(6)4-12)16(13,14)15/h1-3H,(H2,13,14,15) |
| InChIKey | IMBCBLLBPNMSNV-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 83.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.20 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |