C15H14F3NO3S — CID 175046961
2-[(4-methoxyphenyl)methyl]-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 175046961) has the molecular formula C15H14F3NO3S and a molecular weight of 345.34 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)methyl]-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 2-[(4-methoxyphenyl)methyl]-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 175046961 |
| Molecular Formula | C15H14F3NO3S |
| Molecular Weight | 345.34 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | 2-[(4-methoxyphenyl)methyl]-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | COc1ccc(Cc2c(C(F)(F)F)cccc2S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C15H14F3NO3S/c1-22-11-7-5-10(6-8-11)9-12-13(15(16,17)18)3-2-4-14(12)23(19,20)21/h2-8H,9H2,1H3,(H2,19,20,21) |
| InChIKey | LIKDHLYZKIWPGE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |