About 2-bromo-6-(trifluoromethyl)benzonitrile;2-iodo-1,3-dimethylbenzene
2-bromo-6-(trifluoromethyl)benzonitrile;2-iodo-1,3-dimethylbenzene (PubChem CID 174883127) has the molecular formula C16H12BrF3IN
and a molecular weight of 482.08 g/mol. Its IUPAC name is 2-bromo-6-(trifluoromethyl)benzonitrile;2-iodo-1,3-dimethylbenzene.
Molecular Properties
| Compound Name | 2-bromo-6-(trifluoromethyl)benzonitrile;2-iodo-1,3-dimethylbenzene |
| PubChem CID | 174883127 |
| Molecular Formula | C16H12BrF3IN |
| Molecular Weight | 482.08 g/mol |
| Exact Mass | 480.91 |
| IUPAC Name | 2-bromo-6-(trifluoromethyl)benzonitrile;2-iodo-1,3-dimethylbenzene |
| SMILES | Cc1cccc(C)c1I.N#Cc1c(Br)cccc1C(F)(F)F |
| InChI | InChI=1S/C8H3BrF3N.C8H9I/c9-7-3-1-2-6(5(7)4-13)8(10,11)12;1-6-4-3-5-7(2)8(6)9/h1-3H;3-5H,1-2H3 |
| InChIKey | NIGBEANGSKRDQJ-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 482.08 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-6-(trifluoromethyl)benzonitrile;2-iodo-1,3-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-6-(trifluoromethyl)benzonitrile;2-iodo-1,3-dimethylbenzene?
The IUPAC name of 2-bromo-6-(trifluoromethyl)benzonitrile;2-iodo-1,3-dimethylbenzene (CID 174883127) is 2-bromo-6-(trifluoromethyl)benzonitrile;2-iodo-1,3-dimethylbenzene.
What is the SMILES notation for 2-bromo-6-(trifluoromethyl)benzonitrile;2-iodo-1,3-dimethylbenzene?
The canonical SMILES for 2-bromo-6-(trifluoromethyl)benzonitrile;2-iodo-1,3-dimethylbenzene is Cc1cccc(C)c1I.N#Cc1c(Br)cccc1C(F)(F)F.
What is the InChIKey of 2-bromo-6-(trifluoromethyl)benzonitrile;2-iodo-1,3-dimethylbenzene?
The InChIKey is NIGBEANGSKRDQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H3BrF3N.C8H9I/c9-7-3-1-2-6(5(7)4-13)8(10,11)12;1-6-4-3-5-7(2)8(6)9/h1-3H;3-5H,1-2H3.
What are the key properties of 2-bromo-6-(trifluoromethyl)benzonitrile;2-iodo-1,3-dimethylbenzene?
2-bromo-6-(trifluoromethyl)benzonitrile;2-iodo-1,3-dimethylbenzene has a molecular weight of 482.08 g/mol, XLogP of 6.25, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-6-(trifluoromethyl)benzonitrile;2-iodo-1,3-dimethylbenzene is sourced from PubChem (CID 174883127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).