C11H14F3NO2S2 — CID 23448647
N-tert-butyl-2-sulfanyl-6-(trifluoromethyl)benzenesulfonamide (PubChem CID 23448647) has the molecular formula C11H14F3NO2S2 and a molecular weight of 313.37 g/mol. Its IUPAC name is N-tert-butyl-2-sulfanyl-6-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-tert-butyl-2-sulfanyl-6-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 23448647 |
| Molecular Formula | C11H14F3NO2S2 |
| Molecular Weight | 313.37 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | N-tert-butyl-2-sulfanyl-6-(trifluoromethyl)benzenesulfonamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1c(S)cccc1C(F)(F)F |
| InChI | InChI=1S/C11H14F3NO2S2/c1-10(2,3)15-19(16,17)9-7(11(12,13)14)5-4-6-8(9)18/h4-6,15,18H,1-3H3 |
| InChIKey | ZLFOJMNXZCZSGF-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|