C9H8F3O3S- — CID 152762209
2-ethyl-6-(trifluoromethyl)benzenesulfonate (PubChem CID 152762209) has the molecular formula C9H8F3O3S- and a molecular weight of 253.22 g/mol. Its IUPAC name is 2-ethyl-6-(trifluoromethyl)benzenesulfonate.
| Compound Name | 2-ethyl-6-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 152762209 |
| Molecular Formula | C9H8F3O3S- |
| Molecular Weight | 253.22 g/mol |
| Exact Mass | 253.02 |
| IUPAC Name | 2-ethyl-6-(trifluoromethyl)benzenesulfonate |
| SMILES | CCc1cccc(C(F)(F)F)c1S(=O)(=O)[O-] |
| InChI | InChI=1S/C9H9F3O3S/c1-2-6-4-3-5-7(9(10,11)12)8(6)16(13,14)15/h3-5H,2H2,1H3,(H,13,14,15)/p-1 |
| InChIKey | WOKRZXAIHJWVCK-UHFFFAOYSA-M |
| XLogP | 2.17 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.22 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|