About sodium 2-(2,2-difluoroethoxy)-6-(trifluoromethyl)benzenesulfonate
sodium 2-(2,2-difluoroethoxy)-6-(trifluoromethyl)benzenesulfonate (PubChem CID 169437954) has the molecular formula C9H6F5NaO4S
and a molecular weight of 328.19 g/mol. Its IUPAC name is sodium 2-(2,2-difluoroethoxy)-6-(trifluoromethyl)benzenesulfonate.
Molecular Properties
| Compound Name | sodium 2-(2,2-difluoroethoxy)-6-(trifluoromethyl)benzenesulfonate |
| PubChem CID | 169437954 |
| Molecular Formula | C9H6F5NaO4S |
| Molecular Weight | 328.19 g/mol |
| Exact Mass | 327.98 |
| IUPAC Name | sodium 2-(2,2-difluoroethoxy)-6-(trifluoromethyl)benzenesulfonate |
| SMILES | O=S(=O)([O-])c1c(OCC(F)F)cccc1C(F)(F)F.[Na+] |
| InChI | InChI=1S/C9H7F5O4S.Na/c10-7(11)4-18-6-3-1-2-5(9(12,13)14)8(6)19(15,16)17;/h1-3,7H,4H2,(H,15,16,17);/q;+1/p-1 |
| InChIKey | CHXHEMNGMDBHMY-UHFFFAOYSA-M |
| XLogP | -0.74 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.19 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium 2-(2,2-difluoroethoxy)-6-(trifluoromethyl)benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2-(2,2-difluoroethoxy)-6-(trifluoromethyl)benzenesulfonate?
The IUPAC name of sodium 2-(2,2-difluoroethoxy)-6-(trifluoromethyl)benzenesulfonate (CID 169437954) is sodium 2-(2,2-difluoroethoxy)-6-(trifluoromethyl)benzenesulfonate.
What is the SMILES notation for sodium 2-(2,2-difluoroethoxy)-6-(trifluoromethyl)benzenesulfonate?
The canonical SMILES for sodium 2-(2,2-difluoroethoxy)-6-(trifluoromethyl)benzenesulfonate is O=S(=O)([O-])c1c(OCC(F)F)cccc1C(F)(F)F.[Na+].
What is the InChIKey of sodium 2-(2,2-difluoroethoxy)-6-(trifluoromethyl)benzenesulfonate?
The InChIKey is CHXHEMNGMDBHMY-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H7F5O4S.Na/c10-7(11)4-18-6-3-1-2-5(9(12,13)14)8(6)19(15,16)17;/h1-3,7H,4H2,(H,15,16,17);/q;+1/p-1.
What are the key properties of sodium 2-(2,2-difluoroethoxy)-6-(trifluoromethyl)benzenesulfonate?
sodium 2-(2,2-difluoroethoxy)-6-(trifluoromethyl)benzenesulfonate has a molecular weight of 328.19 g/mol, XLogP of -0.74, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-(2,2-difluoroethoxy)-6-(trifluoromethyl)benzenesulfonate is sourced from PubChem (CID 169437954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).