C9H6F5NaO4S — CID 169437954
sodium 2-(2,2-difluoroethoxy)-6-(trifluoromethyl)benzenesulfonate (PubChem CID 169437954) has the molecular formula C9H6F5NaO4S and a molecular weight of 328.19 g/mol. Its IUPAC name is sodium 2-(2,2-difluoroethoxy)-6-(trifluoromethyl)benzenesulfonate.
| Compound Name | sodium 2-(2,2-difluoroethoxy)-6-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 169437954 |
| Molecular Formula | C9H6F5NaO4S |
| Molecular Weight | 328.19 g/mol |
| Exact Mass | 327.98 |
| IUPAC Name | sodium 2-(2,2-difluoroethoxy)-6-(trifluoromethyl)benzenesulfonate |
| SMILES | O=S(=O)([O-])c1c(OCC(F)F)cccc1C(F)(F)F.[Na+] |
| InChI | InChI=1S/C9H7F5O4S.Na/c10-7(11)4-18-6-3-1-2-5(9(12,13)14)8(6)19(15,16)17;/h1-3,7H,4H2,(H,15,16,17);/q;+1/p-1 |
| InChIKey | CHXHEMNGMDBHMY-UHFFFAOYSA-M |
| XLogP | -0.74 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.19 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|