C8H7F3O — CID 64766194
1-(2,2-difluoroethoxy)-2-fluorobenzene (PubChem CID 64766194) has the molecular formula C8H7F3O and a molecular weight of 176.14 g/mol. Its IUPAC name is 1-(2,2-difluoroethoxy)-2-fluorobenzene.
| Compound Name | 1-(2,2-difluoroethoxy)-2-fluorobenzene |
|---|---|
| PubChem CID | 64766194 |
| Molecular Formula | C8H7F3O |
| Molecular Weight | 176.14 g/mol |
| Exact Mass | 176.04 |
| IUPAC Name | 1-(2,2-difluoroethoxy)-2-fluorobenzene |
| SMILES | Fc1ccccc1OCC(F)F |
| InChI | InChI=1S/C8H7F3O/c9-6-3-1-2-4-7(6)12-5-8(10)11/h1-4,8H,5H2 |
| InChIKey | FNTPAJMUTUUVME-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.14 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |