C8H9F2NO — CID 131160464
3-(2,2-difluoroethoxy)-2-methylpyridine (PubChem CID 131160464) has the molecular formula C8H9F2NO and a molecular weight of 173.16 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-2-methylpyridine.
| Compound Name | 3-(2,2-difluoroethoxy)-2-methylpyridine |
|---|---|
| PubChem CID | 131160464 |
| Molecular Formula | C8H9F2NO |
| Molecular Weight | 173.16 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-2-methylpyridine |
| SMILES | Cc1ncccc1OCC(F)F |
| InChI | InChI=1S/C8H9F2NO/c1-6-7(3-2-4-11-6)12-5-8(9)10/h2-4,8H,5H2,1H3 |
| InChIKey | DRLRKGFJRUWQSI-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.16 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |