C11H15FO3 — CID 117236856
2-[(2-fluorophenoxy)methyl]butane-1,4-diol (PubChem CID 117236856) has the molecular formula C11H15FO3 and a molecular weight of 214.24 g/mol. Its IUPAC name is 2-[(2-fluorophenoxy)methyl]butane-1,4-diol.
| Compound Name | 2-[(2-fluorophenoxy)methyl]butane-1,4-diol |
|---|---|
| PubChem CID | 117236856 |
| Molecular Formula | C11H15FO3 |
| Molecular Weight | 214.24 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 2-[(2-fluorophenoxy)methyl]butane-1,4-diol |
| SMILES | OCCC(CO)COc1ccccc1F |
| InChI | InChI=1S/C11H15FO3/c12-10-3-1-2-4-11(10)15-8-9(7-14)5-6-13/h1-4,9,13-14H,5-8H2 |
| InChIKey | KHDMVSUYQXGMDE-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.24 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |