About sodium;hydride;2-methyl-6-(trifluoromethyl)benzenesulfonic acid
sodium;hydride;2-methyl-6-(trifluoromethyl)benzenesulfonic acid (PubChem CID 173302154) has the molecular formula C8H8F3NaO3S
and a molecular weight of 264.20 g/mol. Its IUPAC name is sodium;hydride;2-methyl-6-(trifluoromethyl)benzenesulfonic acid.
Molecular Properties
| Compound Name | sodium;hydride;2-methyl-6-(trifluoromethyl)benzenesulfonic acid |
| PubChem CID | 173302154 |
| Molecular Formula | C8H8F3NaO3S |
| Molecular Weight | 264.20 g/mol |
| Exact Mass | 264.00 |
| IUPAC Name | sodium;hydride;2-methyl-6-(trifluoromethyl)benzenesulfonic acid |
| SMILES | Cc1cccc(C(F)(F)F)c1S(=O)(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C8H7F3O3S.Na.H/c1-5-3-2-4-6(8(9,10)11)7(5)15(12,13)14;;/h2-4H,1H3,(H,12,13,14);;/q;+1;-1 |
| InChIKey | WEOXPWMWHQFZPY-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.20 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;2-methyl-6-(trifluoromethyl)benzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;2-methyl-6-(trifluoromethyl)benzenesulfonic acid?
The IUPAC name of sodium;hydride;2-methyl-6-(trifluoromethyl)benzenesulfonic acid (CID 173302154) is sodium;hydride;2-methyl-6-(trifluoromethyl)benzenesulfonic acid.
What is the SMILES notation for sodium;hydride;2-methyl-6-(trifluoromethyl)benzenesulfonic acid?
The canonical SMILES for sodium;hydride;2-methyl-6-(trifluoromethyl)benzenesulfonic acid is Cc1cccc(C(F)(F)F)c1S(=O)(=O)O.[H-].[Na+].
What is the InChIKey of sodium;hydride;2-methyl-6-(trifluoromethyl)benzenesulfonic acid?
The InChIKey is WEOXPWMWHQFZPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7F3O3S.Na.H/c1-5-3-2-4-6(8(9,10)11)7(5)15(12,13)14;;/h2-4H,1H3,(H,12,13,14);;/q;+1;-1.
What are the key properties of sodium;hydride;2-methyl-6-(trifluoromethyl)benzenesulfonic acid?
sodium;hydride;2-methyl-6-(trifluoromethyl)benzenesulfonic acid has a molecular weight of 264.20 g/mol, XLogP of -0.62, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;2-methyl-6-(trifluoromethyl)benzenesulfonic acid is sourced from PubChem (CID 173302154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).