About 1,2-difluoro-3-(trifluoromethyl)benzene;sulfuryl dichloride
1,2-difluoro-3-(trifluoromethyl)benzene;sulfuryl dichloride (PubChem CID 174535656) has the molecular formula C7H3Cl2F5O2S
and a molecular weight of 317.06 g/mol. Its IUPAC name is 1,2-difluoro-3-(trifluoromethyl)benzene;sulfuryl dichloride.
Analyze 1,2-difluoro-3-(trifluoromethyl)benzene;sulfuryl dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-difluoro-3-(trifluoromethyl)benzene;sulfuryl dichloride?
The IUPAC name of 1,2-difluoro-3-(trifluoromethyl)benzene;sulfuryl dichloride (CID 174535656) is 1,2-difluoro-3-(trifluoromethyl)benzene;sulfuryl dichloride.
What is the SMILES notation for 1,2-difluoro-3-(trifluoromethyl)benzene;sulfuryl dichloride?
The canonical SMILES for 1,2-difluoro-3-(trifluoromethyl)benzene;sulfuryl dichloride is Fc1cccc(C(F)(F)F)c1F.O=S(=O)(Cl)Cl.
What is the InChIKey of 1,2-difluoro-3-(trifluoromethyl)benzene;sulfuryl dichloride?
The InChIKey is RULGRGWGOOQYIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3F5.Cl2O2S/c8-5-3-1-2-4(6(5)9)7(10,11)12;1-5(2,3)4/h1-3H;.
What are the key properties of 1,2-difluoro-3-(trifluoromethyl)benzene;sulfuryl dichloride?
1,2-difluoro-3-(trifluoromethyl)benzene;sulfuryl dichloride has a molecular weight of 317.06 g/mol, XLogP of 3.69, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-difluoro-3-(trifluoromethyl)benzene;sulfuryl dichloride is sourced from PubChem (CID 174535656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).