1,2-difluoro-3-(trifluoromethyl)benzene;sulfuryl dichloride

C7H3Cl2F5O2S — CID 174535656

IUPAC1,2-difluoro-3-(trifluoromethyl)benzene;sulfuryl dichloride
SMILESFc1cccc(C(F)(F)F)c1F.O=S(=O)(Cl)Cl
InChIInChI=1S/C7H3F5.Cl2O2S/c8-5-3-1-2-4(6(5)9)7(10,11)12;1-5(2,3)4/h1-3H;
InChIKeyRULGRGWGOOQYIF-UHFFFAOYSA-N
MW317.06 g/mol
LogP3.69
Rot. Bonds

About 1,2-difluoro-3-(trifluoromethyl)benzene;sulfuryl dichloride

1,2-difluoro-3-(trifluoromethyl)benzene;sulfuryl dichloride (PubChem CID 174535656) has the molecular formula C7H3Cl2F5O2S and a molecular weight of 317.06 g/mol. Its IUPAC name is 1,2-difluoro-3-(trifluoromethyl)benzene;sulfuryl dichloride.

Molecular Properties

Compound Name1,2-difluoro-3-(trifluoromethyl)benzene;sulfuryl dichloride
PubChem CID174535656
Molecular FormulaC7H3Cl2F5O2S
Molecular Weight317.06 g/mol
Exact Mass315.92
IUPAC Name1,2-difluoro-3-(trifluoromethyl)benzene;sulfuryl dichloride
SMILESFc1cccc(C(F)(F)F)c1F.O=S(=O)(Cl)Cl
InChIInChI=1S/C7H3F5.Cl2O2S/c8-5-3-1-2-4(6(5)9)7(10,11)12;1-5(2,3)4/h1-3H;
InChIKeyRULGRGWGOOQYIF-UHFFFAOYSA-N
XLogP3.69
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500317.06
LogP ≤ 53.69
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze 1,2-difluoro-3-(trifluoromethyl)benzene;sulfuryl dichloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,2-difluoro-3-(trifluoromethyl)benzene;sulfuryl dichloride?
The IUPAC name of 1,2-difluoro-3-(trifluoromethyl)benzene;sulfuryl dichloride (CID 174535656) is 1,2-difluoro-3-(trifluoromethyl)benzene;sulfuryl dichloride.
What is the SMILES notation for 1,2-difluoro-3-(trifluoromethyl)benzene;sulfuryl dichloride?
The canonical SMILES for 1,2-difluoro-3-(trifluoromethyl)benzene;sulfuryl dichloride is Fc1cccc(C(F)(F)F)c1F.O=S(=O)(Cl)Cl.
What is the InChIKey of 1,2-difluoro-3-(trifluoromethyl)benzene;sulfuryl dichloride?
The InChIKey is RULGRGWGOOQYIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3F5.Cl2O2S/c8-5-3-1-2-4(6(5)9)7(10,11)12;1-5(2,3)4/h1-3H;.
What are the key properties of 1,2-difluoro-3-(trifluoromethyl)benzene;sulfuryl dichloride?
1,2-difluoro-3-(trifluoromethyl)benzene;sulfuryl dichloride has a molecular weight of 317.06 g/mol, XLogP of 3.69, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-difluoro-3-(trifluoromethyl)benzene;sulfuryl dichloride is sourced from PubChem (CID 174535656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).