C16H6Cl2F12Sn — CID 12073575
bis[2,6-bis(trifluoromethyl)phenyl]-dichlorostannane (PubChem CID 12073575) has the molecular formula C16H6Cl2F12Sn and a molecular weight of 615.82 g/mol. Its IUPAC name is bis[2,6-bis(trifluoromethyl)phenyl]-dichlorostannane.
| Compound Name | bis[2,6-bis(trifluoromethyl)phenyl]-dichlorostannane |
|---|---|
| PubChem CID | 12073575 |
| Molecular Formula | C16H6Cl2F12Sn |
| Molecular Weight | 615.82 g/mol |
| Exact Mass | 615.87 |
| IUPAC Name | bis[2,6-bis(trifluoromethyl)phenyl]-dichlorostannane |
| SMILES | FC(F)(F)c1cccc(C(F)(F)F)c1[Sn](Cl)(Cl)c1c(C(F)(F)F)cccc1C(F)(F)F |
| InChI | InChI=1S/2C8H3F6.2ClH.Sn/c2*9-7(10,11)5-2-1-3-6(4-5)8(12,13)14;;;/h2*1-3H;2*1H;/q;;;;+2/p-2 |
| InChIKey | RDHPCGRURGNKCA-UHFFFAOYSA-L |
| XLogP | 6.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.82 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |