C8H3Cl2F6P — CID 15031708
[2,6-bis(trifluoromethyl)phenyl]-dichlorophosphane (PubChem CID 15031708) has the molecular formula C8H3Cl2F6P and a molecular weight of 314.98 g/mol. Its IUPAC name is [2,6-bis(trifluoromethyl)phenyl]-dichlorophosphane.
| Compound Name | [2,6-bis(trifluoromethyl)phenyl]-dichlorophosphane |
|---|---|
| PubChem CID | 15031708 |
| Molecular Formula | C8H3Cl2F6P |
| Molecular Weight | 314.98 g/mol |
| Exact Mass | 313.93 |
| IUPAC Name | [2,6-bis(trifluoromethyl)phenyl]-dichlorophosphane |
| SMILES | FC(F)(F)c1cccc(C(F)(F)F)c1P(Cl)Cl |
| InChI | InChI=1S/C8H3Cl2F6P/c9-17(10)6-4(7(11,12)13)2-1-3-5(6)8(14,15)16/h1-3H |
| InChIKey | LMLBXYUJHZOGSQ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.98 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|